C11H9BrCl2N4O2S — CID 107793260
N-(4-bromo-2,3-dichlorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 107793260) has the molecular formula C11H9BrCl2N4O2S and a molecular weight of 412.10 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 107793260 |
| Molecular Formula | C11H9BrCl2N4O2S |
| Molecular Weight | 412.10 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2ccc(Br)c(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C11H9BrCl2N4O2S/c1-15-11-16-4-6(5-17-11)21(19,20)18-8-3-2-7(12)9(13)10(8)14/h2-5,18H,1H3,(H,15,16,17) |
| InChIKey | JFMZSGGOFGCCON-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|