C12H8BrCl2NO3S — CID 107791874
N-(4-bromo-2,3-dichlorophenyl)-3-hydroxybenzenesulfonamide (PubChem CID 107791874) has the molecular formula C12H8BrCl2NO3S and a molecular weight of 397.08 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-3-hydroxybenzenesulfonamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 107791874 |
| Molecular Formula | C12H8BrCl2NO3S |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 394.88 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-3-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)c(Cl)c1Cl)c1cccc(O)c1 |
| InChI | InChI=1S/C12H8BrCl2NO3S/c13-9-4-5-10(12(15)11(9)14)16-20(18,19)8-3-1-2-7(17)6-8/h1-6,16-17H |
| InChIKey | JFBQCKAOLOLLLO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|