C13H11Br2NO4S — CID 103416212
N-(2,4-dibromo-5-methoxyphenyl)-3-hydroxybenzenesulfonamide (PubChem CID 103416212) has the molecular formula C13H11Br2NO4S and a molecular weight of 437.11 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-3-hydroxybenzenesulfonamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 103416212 |
| Molecular Formula | C13H11Br2NO4S |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 434.88 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-3-hydroxybenzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cccc(O)c2)c(Br)cc1Br |
| InChI | InChI=1S/C13H11Br2NO4S/c1-20-13-7-12(10(14)6-11(13)15)16-21(18,19)9-4-2-3-8(17)5-9/h2-7,16-17H,1H3 |
| InChIKey | BXYQCTJYIRIJBX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |