C11H8Br2Cl2N4 — CID 107794856
5-bromo-4-N-(4-bromo-2,3-dichlorophenyl)-2-N-methylpyrimidine-2,4-diamine (PubChem CID 107794856) has the molecular formula C11H8Br2Cl2N4 and a molecular weight of 426.93 g/mol. Its IUPAC name is 5-bromo-4-N-(4-bromo-2,3-dichlorophenyl)-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(4-bromo-2,3-dichlorophenyl)-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 107794856 |
| Molecular Formula | C11H8Br2Cl2N4 |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 423.85 |
| IUPAC Name | 5-bromo-4-N-(4-bromo-2,3-dichlorophenyl)-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1ncc(Br)c(Nc2ccc(Br)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C11H8Br2Cl2N4/c1-16-11-17-4-6(13)10(19-11)18-7-3-2-5(12)8(14)9(7)15/h2-4H,1H3,(H2,16,17,18,19) |
| InChIKey | UEMQMVXGNHAQQP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|