C12H13BrCl2N6 — CID 107794861
4-N-(4-bromo-2,3-dichlorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 107794861) has the molecular formula C12H13BrCl2N6 and a molecular weight of 392.09 g/mol. Its IUPAC name is 4-N-(4-bromo-2,3-dichlorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 107794861 |
| Molecular Formula | C12H13BrCl2N6 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc(Br)c(Cl)c2Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H13BrCl2N6/c1-16-10-18-11(20-12(19-10)21(2)3)17-7-5-4-6(13)8(14)9(7)15/h4-5H,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | MSCKNNQSKRVBLE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|