C12H14F2N6 — CID 80759355
4-N-(2,5-difluorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80759355) has the molecular formula C12H14F2N6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-N-(2,5-difluorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,5-difluorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80759355 |
| Molecular Formula | C12H14F2N6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-N-(2,5-difluorophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2cc(F)ccc2F)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H14F2N6/c1-15-10-17-11(19-12(18-10)20(2)3)16-9-6-7(13)4-5-8(9)14/h4-6H,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | FMUWQNQNSFKHKW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |