C11H12BrF2N7 — CID 107608454
2-N-(4-bromo-2,5-difluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 107608454) has the molecular formula C11H12BrF2N7 and a molecular weight of 360.17 g/mol. Its IUPAC name is 2-N-(4-bromo-2,5-difluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-bromo-2,5-difluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 107608454 |
| Molecular Formula | C11H12BrF2N7 |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-N-(4-bromo-2,5-difluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(NN)nc(Nc2cc(F)c(Br)cc2F)n1 |
| InChI | InChI=1S/C11H12BrF2N7/c1-21(2)11-18-9(17-10(19-11)20-15)16-8-4-6(13)5(12)3-7(8)14/h3-4H,15H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | LIKPDFJWHGEGRH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|