C12H13FN8 — CID 80902716
5-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]-2-fluorobenzonitrile (PubChem CID 80902716) has the molecular formula C12H13FN8 and a molecular weight of 288.29 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]-2-fluorobenzonitrile.
| Compound Name | 5-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 80902716 |
| Molecular Formula | C12H13FN8 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]-2-fluorobenzonitrile |
| SMILES | CN(C)c1nc(NN)nc(Nc2ccc(F)c(C#N)c2)n1 |
| InChI | InChI=1S/C12H13FN8/c1-21(2)12-18-10(17-11(19-12)20-15)16-8-3-4-9(13)7(5-8)6-14/h3-5H,15H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | WWWCWIQRPUONJS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|