C14H21N7 — CID 80887308
6-hydrazinyl-4-N,4-N-dimethyl-2-N-(4-propylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80887308) has the molecular formula C14H21N7 and a molecular weight of 287.37 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(4-propylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(4-propylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80887308 |
| Molecular Formula | C14H21N7 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-dimethyl-2-N-(4-propylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCc1ccc(Nc2nc(NN)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C14H21N7/c1-4-5-10-6-8-11(9-7-10)16-12-17-13(20-15)19-14(18-12)21(2)3/h6-9H,4-5,15H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | QEBFTRFKLOSCKN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|