C13H18BrN7 — CID 81287998
2-N-(4-bromo-2-ethylphenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 81287998) has the molecular formula C13H18BrN7 and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-N-(4-bromo-2-ethylphenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-bromo-2-ethylphenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 81287998 |
| Molecular Formula | C13H18BrN7 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-N-(4-bromo-2-ethylphenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1cc(Br)ccc1Nc1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H18BrN7/c1-4-8-7-9(14)5-6-10(8)16-11-17-12(20-15)19-13(18-11)21(2)3/h5-7H,4,15H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | LUOIQYWFEOJTDI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|