C10H14BrN — CID 21082647
4-bromo-2-ethyl-N,N-dimethylaniline (PubChem CID 21082647) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is 4-bromo-2-ethyl-N,N-dimethylaniline.
| Compound Name | 4-bromo-2-ethyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 21082647 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-bromo-2-ethyl-N,N-dimethylaniline |
| SMILES | CCc1cc(Br)ccc1N(C)C |
| InChI | InChI=1S/C10H14BrN/c1-4-8-7-9(11)5-6-10(8)12(2)3/h5-7H,4H2,1-3H3 |
| InChIKey | NCQPIWYJHCZJPB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |