C13H21BrN2 — CID 114525227
N-(4-bromo-2-ethylphenyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 114525227) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(4-bromo-2-ethylphenyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114525227 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCc1cc(Br)ccc1NCCCN(C)C |
| InChI | InChI=1S/C13H21BrN2/c1-4-11-10-12(14)6-7-13(11)15-8-5-9-16(2)3/h6-7,10,15H,4-5,8-9H2,1-3H3 |
| InChIKey | PHTZSTXLGQYDQQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|