C14H19BrN2 — CID 81292133
4-(4-bromo-2-ethylanilino)-2,2-dimethylbutanenitrile (PubChem CID 81292133) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 4-(4-bromo-2-ethylanilino)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(4-bromo-2-ethylanilino)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 81292133 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-(4-bromo-2-ethylanilino)-2,2-dimethylbutanenitrile |
| SMILES | CCc1cc(Br)ccc1NCCC(C)(C)C#N |
| InChI | InChI=1S/C14H19BrN2/c1-4-11-9-12(15)5-6-13(11)17-8-7-14(2,3)10-16/h5-6,9,17H,4,7-8H2,1-3H3 |
| InChIKey | PQOSIHSWEPATGF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |