C14H17BrN2 — CID 81292455
2-[1-[(4-bromo-2-ethylanilino)methyl]cyclopropyl]acetonitrile (PubChem CID 81292455) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 2-[1-[(4-bromo-2-ethylanilino)methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(4-bromo-2-ethylanilino)methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 81292455 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[1-[(4-bromo-2-ethylanilino)methyl]cyclopropyl]acetonitrile |
| SMILES | CCc1cc(Br)ccc1NCC1(CC#N)CC1 |
| InChI | InChI=1S/C14H17BrN2/c1-2-11-9-12(15)3-4-13(11)17-10-14(5-6-14)7-8-16/h3-4,9,17H,2,5-7,10H2,1H3 |
| InChIKey | CXCPYYSNRYPWQM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |