C10H11BrN2O2S — CID 81291679
N-(4-bromo-2-ethylphenyl)-1-cyanomethanesulfonamide (PubChem CID 81291679) has the molecular formula C10H11BrN2O2S and a molecular weight of 303.18 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-1-cyanomethanesulfonamide.
| Compound Name | N-(4-bromo-2-ethylphenyl)-1-cyanomethanesulfonamide |
|---|---|
| PubChem CID | 81291679 |
| Molecular Formula | C10H11BrN2O2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-1-cyanomethanesulfonamide |
| SMILES | CCc1cc(Br)ccc1NS(=O)(=O)CC#N |
| InChI | InChI=1S/C10H11BrN2O2S/c1-2-8-7-9(11)3-4-10(8)13-16(14,15)6-5-12/h3-4,7,13H,2,6H2,1H3 |
| InChIKey | BYKJJEIFHQALBE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |