C11H14BrNO4S — CID 81292251
3-[(4-bromo-2-ethylphenyl)sulfamoyl]propanoic acid (PubChem CID 81292251) has the molecular formula C11H14BrNO4S and a molecular weight of 336.21 g/mol. Its IUPAC name is 3-[(4-bromo-2-ethylphenyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(4-bromo-2-ethylphenyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 81292251 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3-[(4-bromo-2-ethylphenyl)sulfamoyl]propanoic acid |
| SMILES | CCc1cc(Br)ccc1NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H14BrNO4S/c1-2-8-7-9(12)3-4-10(8)13-18(16,17)6-5-11(14)15/h3-4,7,13H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | GEWLCGYIFVZCLL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |