3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid

C13H19NO4S — CID 28514287

IUPAC3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid
SMILESCCc1cccc(CC)c1NS(=O)(=O)CCC(=O)O
InChIInChI=1S/C13H19NO4S/c1-3-10-6-5-7-11(4-2)13(10)14-19(17,18)9-8-12(15)16/h5-7,14H,3-4,8-9H2,1-2H3,(H,15,16)
InChIKeyCHKFBFUJOJQKGU-UHFFFAOYSA-N
MW285.36 g/mol
LogP2.03
Rot. Bonds7

About 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid

3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid (PubChem CID 28514287) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid.

Molecular Properties

Compound Name3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid
PubChem CID28514287
Molecular FormulaC13H19NO4S
Molecular Weight285.36 g/mol
Exact Mass285.10
IUPAC Name3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid
SMILESCCc1cccc(CC)c1NS(=O)(=O)CCC(=O)O
InChIInChI=1S/C13H19NO4S/c1-3-10-6-5-7-11(4-2)13(10)14-19(17,18)9-8-12(15)16/h5-7,14H,3-4,8-9H2,1-2H3,(H,15,16)
InChIKeyCHKFBFUJOJQKGU-UHFFFAOYSA-N
XLogP2.03
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.36
LogP ≤ 52.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid?
The IUPAC name of 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid (CID 28514287) is 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid.
What is the SMILES notation for 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid?
The canonical SMILES for 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid is CCc1cccc(CC)c1NS(=O)(=O)CCC(=O)O.
What is the InChIKey of 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid?
The InChIKey is CHKFBFUJOJQKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4S/c1-3-10-6-5-7-11(4-2)13(10)14-19(17,18)9-8-12(15)16/h5-7,14H,3-4,8-9H2,1-2H3,(H,15,16).
What are the key properties of 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid?
3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid has a molecular weight of 285.36 g/mol, XLogP of 2.03, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-diethylphenyl)sulfamoyl]propanoic acid is sourced from PubChem (CID 28514287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).