C14H24N2O2S — CID 61456563
4-amino-N-(2,6-diethylphenyl)butane-1-sulfonamide (PubChem CID 61456563) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-amino-N-(2,6-diethylphenyl)butane-1-sulfonamide.
| Compound Name | 4-amino-N-(2,6-diethylphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 61456563 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-amino-N-(2,6-diethylphenyl)butane-1-sulfonamide |
| SMILES | CCc1cccc(CC)c1NS(=O)(=O)CCCCN |
| InChI | InChI=1S/C14H24N2O2S/c1-3-12-8-7-9-13(4-2)14(12)16-19(17,18)11-6-5-10-15/h7-9,16H,3-6,10-11,15H2,1-2H3 |
| InChIKey | QDDUXSKTCQPJJO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|