C9H11F2NO2S — CID 60640758
N-(2,6-difluorophenyl)propane-1-sulfonamide (PubChem CID 60640758) has the molecular formula C9H11F2NO2S and a molecular weight of 235.25 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)propane-1-sulfonamide.
| Compound Name | N-(2,6-difluorophenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60640758 |
| Molecular Formula | C9H11F2NO2S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | N-(2,6-difluorophenyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C9H11F2NO2S/c1-2-6-15(13,14)12-9-7(10)4-3-5-8(9)11/h3-5,12H,2,6H2,1H3 |
| InChIKey | KXINBJUVOHPVGU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |