C10H14BrFN2O2S — CID 106089645
N-(2-bromo-6-fluorophenyl)-3-(methylamino)propane-1-sulfonamide (PubChem CID 106089645) has the molecular formula C10H14BrFN2O2S and a molecular weight of 325.20 g/mol. Its IUPAC name is N-(2-bromo-6-fluorophenyl)-3-(methylamino)propane-1-sulfonamide.
| Compound Name | N-(2-bromo-6-fluorophenyl)-3-(methylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106089645 |
| Molecular Formula | C10H14BrFN2O2S |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | N-(2-bromo-6-fluorophenyl)-3-(methylamino)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)Nc1c(F)cccc1Br |
| InChI | InChI=1S/C10H14BrFN2O2S/c1-13-6-3-7-17(15,16)14-10-8(11)4-2-5-9(10)12/h2,4-5,13-14H,3,6-7H2,1H3 |
| InChIKey | ORMZOSPNFGAJEW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|