C11H15BrF2N2O2S — CID 106066644
N-(4-bromo-2,6-difluorophenyl)-4-(methylamino)butane-1-sulfonamide (PubChem CID 106066644) has the molecular formula C11H15BrF2N2O2S and a molecular weight of 357.22 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-4-(methylamino)butane-1-sulfonamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-4-(methylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106066644 |
| Molecular Formula | C11H15BrF2N2O2S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-4-(methylamino)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H15BrF2N2O2S/c1-15-4-2-3-5-19(17,18)16-11-9(13)6-8(12)7-10(11)14/h6-7,15-16H,2-5H2,1H3 |
| InChIKey | FFWANSHJOITUTN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|