C11H16Cl2N2O2S — CID 114141118
N-(3,5-dichlorophenyl)-4-(methylamino)butane-1-sulfonamide (PubChem CID 114141118) has the molecular formula C11H16Cl2N2O2S and a molecular weight of 311.23 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-(methylamino)butane-1-sulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-(methylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114141118 |
| Molecular Formula | C11H16Cl2N2O2S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-(methylamino)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N2O2S/c1-14-4-2-3-5-18(16,17)15-11-7-9(12)6-10(13)8-11/h6-8,14-15H,2-5H2,1H3 |
| InChIKey | GEWRHAVPLQDQGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|