C13H21ClN2O4S — CID 106057660
N-(4-chloro-2,5-dimethoxyphenyl)-4-(methylamino)butane-1-sulfonamide (PubChem CID 106057660) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-(methylamino)butane-1-sulfonamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(methylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106057660 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-(methylamino)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C13H21ClN2O4S/c1-15-6-4-5-7-21(17,18)16-11-9-12(19-2)10(14)8-13(11)20-3/h8-9,15-16H,4-7H2,1-3H3 |
| InChIKey | KADRAHDQINVDCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|