C12H19FN2O3S — CID 106071793
N-(2-fluoro-5-methoxyphenyl)-4-(methylamino)butane-1-sulfonamide (PubChem CID 106071793) has the molecular formula C12H19FN2O3S and a molecular weight of 290.36 g/mol. Its IUPAC name is N-(2-fluoro-5-methoxyphenyl)-4-(methylamino)butane-1-sulfonamide.
| Compound Name | N-(2-fluoro-5-methoxyphenyl)-4-(methylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106071793 |
| Molecular Formula | C12H19FN2O3S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(2-fluoro-5-methoxyphenyl)-4-(methylamino)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)Nc1cc(OC)ccc1F |
| InChI | InChI=1S/C12H19FN2O3S/c1-14-7-3-4-8-19(16,17)15-12-9-10(18-2)5-6-11(12)13/h5-6,9,14-15H,3-4,7-8H2,1-2H3 |
| InChIKey | XPTNZKLTRKZOQH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|