C11H17FN2O3S — CID 106086490
N-(4-fluoro-3-methoxyphenyl)-3-(methylamino)propane-1-sulfonamide (PubChem CID 106086490) has the molecular formula C11H17FN2O3S and a molecular weight of 276.33 g/mol. Its IUPAC name is N-(4-fluoro-3-methoxyphenyl)-3-(methylamino)propane-1-sulfonamide.
| Compound Name | N-(4-fluoro-3-methoxyphenyl)-3-(methylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106086490 |
| Molecular Formula | C11H17FN2O3S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(4-fluoro-3-methoxyphenyl)-3-(methylamino)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)Nc1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C11H17FN2O3S/c1-13-6-3-7-18(15,16)14-9-4-5-10(12)11(8-9)17-2/h4-5,8,13-14H,3,6-7H2,1-2H3 |
| InChIKey | NYCSYLSNMHDXAH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|