C12H19ClN2O2 — CID 82121102
N'-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diamine (PubChem CID 82121102) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is N'-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diamine.
| Compound Name | N'-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 82121102 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N'-(4-chloro-2,5-dimethoxyphenyl)butane-1,4-diamine |
| SMILES | COc1cc(NCCCCN)c(OC)cc1Cl |
| InChI | InChI=1S/C12H19ClN2O2/c1-16-11-8-10(15-6-4-3-5-14)12(17-2)7-9(11)13/h7-8,15H,3-6,14H2,1-2H3 |
| InChIKey | SGAFBHKGUBLABJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|