C13H20ClNO3 — CID 106451234
4-chloro-2,5-dimethoxy-N-(2-propoxyethyl)aniline (PubChem CID 106451234) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 4-chloro-2,5-dimethoxy-N-(2-propoxyethyl)aniline.
| Compound Name | 4-chloro-2,5-dimethoxy-N-(2-propoxyethyl)aniline |
|---|---|
| PubChem CID | 106451234 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-chloro-2,5-dimethoxy-N-(2-propoxyethyl)aniline |
| SMILES | CCCOCCNc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C13H20ClNO3/c1-4-6-18-7-5-15-11-9-12(16-2)10(14)8-13(11)17-3/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | HYIIDJZEHZJPTK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|