C10H14Br2N2O — CID 103411364
N'-(2,4-dibromo-5-methoxyphenyl)propane-1,3-diamine (PubChem CID 103411364) has the molecular formula C10H14Br2N2O and a molecular weight of 338.04 g/mol. Its IUPAC name is N'-(2,4-dibromo-5-methoxyphenyl)propane-1,3-diamine.
| Compound Name | N'-(2,4-dibromo-5-methoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103411364 |
| Molecular Formula | C10H14Br2N2O |
| Molecular Weight | 338.04 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | N'-(2,4-dibromo-5-methoxyphenyl)propane-1,3-diamine |
| SMILES | COc1cc(NCCCN)c(Br)cc1Br |
| InChI | InChI=1S/C10H14Br2N2O/c1-15-10-6-9(14-4-2-3-13)7(11)5-8(10)12/h5-6,14H,2-4,13H2,1H3 |
| InChIKey | DDKZQILUPVHYNC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.04 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|