C11H13Br2NO3 — CID 103412855
3-(2,4-dibromo-5-methoxyanilino)-2-methylpropanoic acid (PubChem CID 103412855) has the molecular formula C11H13Br2NO3 and a molecular weight of 367.04 g/mol. Its IUPAC name is 3-(2,4-dibromo-5-methoxyanilino)-2-methylpropanoic acid.
| Compound Name | 3-(2,4-dibromo-5-methoxyanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103412855 |
| Molecular Formula | C11H13Br2NO3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 3-(2,4-dibromo-5-methoxyanilino)-2-methylpropanoic acid |
| SMILES | COc1cc(NCC(C)C(=O)O)c(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2NO3/c1-6(11(15)16)5-14-9-4-10(17-2)8(13)3-7(9)12/h3-4,6,14H,5H2,1-2H3,(H,15,16) |
| InChIKey | RIJJLJDPBKPZEX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |