C13H16Br2N2O4 — CID 103416262
2-[[(2,4-dibromo-5-methoxyphenyl)carbamoylamino]methyl]butanoic acid (PubChem CID 103416262) has the molecular formula C13H16Br2N2O4 and a molecular weight of 424.09 g/mol. Its IUPAC name is 2-[[(2,4-dibromo-5-methoxyphenyl)carbamoylamino]methyl]butanoic acid.
| Compound Name | 2-[[(2,4-dibromo-5-methoxyphenyl)carbamoylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 103416262 |
| Molecular Formula | C13H16Br2N2O4 |
| Molecular Weight | 424.09 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 2-[[(2,4-dibromo-5-methoxyphenyl)carbamoylamino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)Nc1cc(OC)c(Br)cc1Br)C(=O)O |
| InChI | InChI=1S/C13H16Br2N2O4/c1-3-7(12(18)19)6-16-13(20)17-10-5-11(21-2)9(15)4-8(10)14/h4-5,7H,3,6H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | KSPDPGQYXBCDJN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |