C10H9Br2F3N2O2 — CID 103412409
1-(2,4-dibromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 103412409) has the molecular formula C10H9Br2F3N2O2 and a molecular weight of 406.00 g/mol. Its IUPAC name is 1-(2,4-dibromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2,4-dibromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 103412409 |
| Molecular Formula | C10H9Br2F3N2O2 |
| Molecular Weight | 406.00 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 1-(2,4-dibromo-5-methoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COc1cc(NC(=O)NCC(F)(F)F)c(Br)cc1Br |
| InChI | InChI=1S/C10H9Br2F3N2O2/c1-19-8-3-7(5(11)2-6(8)12)17-9(18)16-4-10(13,14)15/h2-3H,4H2,1H3,(H2,16,17,18) |
| InChIKey | USKCYWIYJSIUJN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.00 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |