C13H18Br2N2O2 — CID 103413783
(2R)-2-amino-N-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethylbutanamide (PubChem CID 103413783) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103413783 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | (2R)-2-amino-N-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethylbutanamide |
| SMILES | COc1cc(NC(=O)[C@H](N)C(C)(C)C)c(Br)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O2/c1-13(2,3)11(16)12(18)17-9-6-10(19-4)8(15)5-7(9)14/h5-6,11H,16H2,1-4H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | YEDNRAUJKTYMHF-NSHDSACASA-N |
| XLogP | 3.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |