C12H14F3N3O3 — CID 72854483
N-[4-methoxy-3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide (PubChem CID 72854483) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is N-[4-methoxy-3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide.
| Compound Name | N-[4-methoxy-3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 72854483 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[4-methoxy-3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O3/c1-7(19)17-8-3-4-10(21-2)9(5-8)18-11(20)16-6-12(13,14)15/h3-5H,6H2,1-2H3,(H,17,19)(H2,16,18,20) |
| InChIKey | CKAXNDLBDWSJPQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |