C11H11F3N2O4 — CID 107208858
2-methoxy-4-(2,2,2-trifluoroethylcarbamoylamino)benzoic acid (PubChem CID 107208858) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-methoxy-4-(2,2,2-trifluoroethylcarbamoylamino)benzoic acid.
| Compound Name | 2-methoxy-4-(2,2,2-trifluoroethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107208858 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-methoxy-4-(2,2,2-trifluoroethylcarbamoylamino)benzoic acid |
| SMILES | COc1cc(NC(=O)NCC(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C11H11F3N2O4/c1-20-8-4-6(2-3-7(8)9(17)18)16-10(19)15-5-11(12,13)14/h2-4H,5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | OAXJBIGQEPGAMY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |