C18H16F3NO5 — CID 71076797
2-methoxy-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoic acid (PubChem CID 71076797) has the molecular formula C18H16F3NO5 and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-methoxy-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-methoxy-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 71076797 |
| Molecular Formula | C18H16F3NO5 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-methoxy-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)O)c(OC)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3NO5/c1-26-12-5-3-10(14(9-12)18(19,20)21)7-16(23)22-11-4-6-13(17(24)25)15(8-11)27-2/h3-6,8-9H,7H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | OLFHWAPSVHCTJS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |