C17H15ClF3NO3 — CID 92670451
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2,5-dimethoxyphenyl)acetamide (PubChem CID 92670451) has the molecular formula C17H15ClF3NO3 and a molecular weight of 373.76 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 92670451 |
| Molecular Formula | C17H15ClF3NO3 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H15ClF3NO3/c1-24-12-4-6-15(25-2)10(7-12)8-16(23)22-11-3-5-14(18)13(9-11)17(19,20)21/h3-7,9H,8H2,1-2H3,(H,22,23) |
| InChIKey | NNZMMOVNNQLQJV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |