C18H15ClF3NO3 — CID 5182616
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 5182616) has the molecular formula C18H15ClF3NO3 and a molecular weight of 385.77 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5182616 |
| Molecular Formula | C18H15ClF3NO3 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(C=CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H15ClF3NO3/c1-25-13-5-7-16(26-2)11(9-13)3-8-17(24)23-12-4-6-15(19)14(10-12)18(20,21)22/h3-10H,1-2H3,(H,23,24) |
| InChIKey | UFRKYMLJIAJYCR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|