C19H21N3O4 — CID 46518249
(E)-3-(2,5-dimethoxyphenyl)-N-[4-(methylcarbamoylamino)phenyl]prop-2-enamide (PubChem CID 46518249) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[4-(methylcarbamoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[4-(methylcarbamoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46518249 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[4-(methylcarbamoylamino)phenyl]prop-2-enamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)/C=C/c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-20-19(24)22-15-7-5-14(6-8-15)21-18(23)11-4-13-12-16(25-2)9-10-17(13)26-3/h4-12H,1-3H3,(H,21,23)(H2,20,22,24)/b11-4+ |
| InChIKey | ZMBOKRGHOBJUGQ-NYYWCZLTSA-N |
| XLogP | 3.11 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|