C23H27N3O4 — CID 108763760
(E)-3-(2,5-dimethoxyphenyl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 108763760) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108763760 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2ccc(C(=O)N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-25-12-14-26(15-13-25)23(28)17-4-7-19(8-5-17)24-22(27)11-6-18-16-20(29-2)9-10-21(18)30-3/h4-11,16H,12-15H2,1-3H3,(H,24,27)/b11-6+ |
| InChIKey | SMFCAHVPBPMDDX-IZZDOVSWSA-N |
| XLogP | 2.74 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|