C17H16F3NO4 — CID 9404556
2-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 9404556) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 9404556 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(OC(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H16F3NO4/c1-23-14-6-3-11(15(10-14)24-2)9-16(22)21-12-4-7-13(8-5-12)25-17(18,19)20/h3-8,10H,9H2,1-2H3,(H,21,22) |
| InChIKey | ZUTIZGHUVJUUTC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |