C20H27NO4 — CID 143433309
2-(2,4-dimethoxyphenyl)-N-[4-(methoxymethyl)phenyl]acetamide;ethane (PubChem CID 143433309) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[4-(methoxymethyl)phenyl]acetamide;ethane.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[4-(methoxymethyl)phenyl]acetamide;ethane |
|---|---|
| PubChem CID | 143433309 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[4-(methoxymethyl)phenyl]acetamide;ethane |
| SMILES | CC.COCc1ccc(NC(=O)Cc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C18H21NO4.C2H6/c1-21-12-13-4-7-15(8-5-13)19-18(20)10-14-6-9-16(22-2)11-17(14)23-3;1-2/h4-9,11H,10,12H2,1-3H3,(H,19,20);1-2H3 |
| InChIKey | YAOXQNZDFHDXBT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |