C12H12N4O4 — CID 107209397
2-methoxy-4-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid (PubChem CID 107209397) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-methoxy-4-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-methoxy-4-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 107209397 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-methoxy-4-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid |
| SMILES | COc1cc(NC(=O)Nc2cn[nH]c2)ccc1C(=O)O |
| InChI | InChI=1S/C12H12N4O4/c1-20-10-4-7(2-3-9(10)11(17)18)15-12(19)16-8-5-13-14-6-8/h2-6H,1H3,(H,13,14)(H,17,18)(H2,15,16,19) |
| InChIKey | QPRRBSYUDZYEIB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |