C11H8F2N4O3 — CID 61210040
2,4-difluoro-5-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid (PubChem CID 61210040) has the molecular formula C11H8F2N4O3 and a molecular weight of 282.21 g/mol. Its IUPAC name is 2,4-difluoro-5-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid.
| Compound Name | 2,4-difluoro-5-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61210040 |
| Molecular Formula | C11H8F2N4O3 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2,4-difluoro-5-(1H-pyrazol-4-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1cn[nH]c1)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C11H8F2N4O3/c12-7-2-8(13)9(1-6(7)10(18)19)17-11(20)16-5-3-14-15-4-5/h1-4H,(H,14,15)(H,18,19)(H2,16,17,20) |
| InChIKey | YCEDZEOSKWXFLU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |