C13H14F2N2O3 — CID 61197047
5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid (PubChem CID 61197047) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid.
| Compound Name | 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 61197047 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid |
| SMILES | O=C(NCC1CCC1)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O3/c14-9-5-10(15)11(4-8(9)12(18)19)17-13(20)16-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,18,19)(H2,16,17,20) |
| InChIKey | ICDPDXJOVPETPZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |