5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid

C13H14F2N2O3 — CID 61197047

IUPAC5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid
SMILESO=C(NCC1CCC1)Nc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C13H14F2N2O3/c14-9-5-10(15)11(4-8(9)12(18)19)17-13(20)16-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,18,19)(H2,16,17,20)
InChIKeyICDPDXJOVPETPZ-UHFFFAOYSA-N
MW284.26 g/mol
LogP2.58
Rot. Bonds4

About 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid

5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid (PubChem CID 61197047) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid.

Molecular Properties

Compound Name5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid
PubChem CID61197047
Molecular FormulaC13H14F2N2O3
Molecular Weight284.26 g/mol
Exact Mass284.10
IUPAC Name5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid
SMILESO=C(NCC1CCC1)Nc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C13H14F2N2O3/c14-9-5-10(15)11(4-8(9)12(18)19)17-13(20)16-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,18,19)(H2,16,17,20)
InChIKeyICDPDXJOVPETPZ-UHFFFAOYSA-N
XLogP2.58
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.26
LogP ≤ 52.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid?
The IUPAC name of 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid (CID 61197047) is 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid.
What is the SMILES notation for 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid?
The canonical SMILES for 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid is O=C(NCC1CCC1)Nc1cc(C(=O)O)c(F)cc1F.
What is the InChIKey of 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid?
The InChIKey is ICDPDXJOVPETPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O3/c14-9-5-10(15)11(4-8(9)12(18)19)17-13(20)16-6-7-2-1-3-7/h4-5,7H,1-3,6H2,(H,18,19)(H2,16,17,20).
What are the key properties of 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid?
5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid has a molecular weight of 284.26 g/mol, XLogP of 2.58, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclobutylmethylcarbamoylamino)-2,4-difluorobenzoic acid is sourced from PubChem (CID 61197047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).