2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid

C10H11F2N3O5S — CID 61202634

IUPAC2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid
SMILESNS(=O)(=O)CCNC(=O)Nc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C10H11F2N3O5S/c11-6-4-7(12)8(3-5(6)9(16)17)15-10(18)14-1-2-21(13,19)20/h3-4H,1-2H2,(H,16,17)(H2,13,19,20)(H2,14,15,18)
InChIKeyZUPSLLPZUOYRJY-UHFFFAOYSA-N
MW323.28 g/mol
LogP0.07
Rot. Bonds5

About 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid

2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid (PubChem CID 61202634) has the molecular formula C10H11F2N3O5S and a molecular weight of 323.28 g/mol. Its IUPAC name is 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid
PubChem CID61202634
Molecular FormulaC10H11F2N3O5S
Molecular Weight323.28 g/mol
Exact Mass323.04
IUPAC Name2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid
SMILESNS(=O)(=O)CCNC(=O)Nc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C10H11F2N3O5S/c11-6-4-7(12)8(3-5(6)9(16)17)15-10(18)14-1-2-21(13,19)20/h3-4H,1-2H2,(H,16,17)(H2,13,19,20)(H2,14,15,18)
InChIKeyZUPSLLPZUOYRJY-UHFFFAOYSA-N
XLogP0.07
TPSA138.59 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.28
LogP ≤ 50.07
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid?
The IUPAC name of 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid (CID 61202634) is 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid.
What is the SMILES notation for 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid?
The canonical SMILES for 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid is NS(=O)(=O)CCNC(=O)Nc1cc(C(=O)O)c(F)cc1F.
What is the InChIKey of 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid?
The InChIKey is ZUPSLLPZUOYRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N3O5S/c11-6-4-7(12)8(3-5(6)9(16)17)15-10(18)14-1-2-21(13,19)20/h3-4H,1-2H2,(H,16,17)(H2,13,19,20)(H2,14,15,18).
What are the key properties of 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid?
2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid has a molecular weight of 323.28 g/mol, XLogP of 0.07, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid is sourced from PubChem (CID 61202634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).