C10H11F2N3O5S — CID 61202634
2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid (PubChem CID 61202634) has the molecular formula C10H11F2N3O5S and a molecular weight of 323.28 g/mol. Its IUPAC name is 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid.
| Compound Name | 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61202634 |
| Molecular Formula | C10H11F2N3O5S |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2,4-difluoro-5-(2-sulfamoylethylcarbamoylamino)benzoic acid |
| SMILES | NS(=O)(=O)CCNC(=O)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C10H11F2N3O5S/c11-6-4-7(12)8(3-5(6)9(16)17)15-10(18)14-1-2-21(13,19)20/h3-4H,1-2H2,(H,16,17)(H2,13,19,20)(H2,14,15,18) |
| InChIKey | ZUPSLLPZUOYRJY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |