C9H6BrF2NO3 — CID 63679678
5-[(2-bromoacetyl)amino]-2,4-difluorobenzoic acid (PubChem CID 63679678) has the molecular formula C9H6BrF2NO3 and a molecular weight of 294.05 g/mol. Its IUPAC name is 5-[(2-bromoacetyl)amino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[(2-bromoacetyl)amino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 63679678 |
| Molecular Formula | C9H6BrF2NO3 |
| Molecular Weight | 294.05 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | 5-[(2-bromoacetyl)amino]-2,4-difluorobenzoic acid |
| SMILES | O=C(CBr)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C9H6BrF2NO3/c10-3-8(14)13-7-1-4(9(15)16)5(11)2-6(7)12/h1-2H,3H2,(H,13,14)(H,15,16) |
| InChIKey | OWFXASLFWRLTGK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.05 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|