C11H12F2N2O4 — CID 79472946
5-[[2-(2-aminoethoxy)acetyl]amino]-2,4-difluorobenzoic acid (PubChem CID 79472946) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 5-[[2-(2-aminoethoxy)acetyl]amino]-2,4-difluorobenzoic acid.
| Compound Name | 5-[[2-(2-aminoethoxy)acetyl]amino]-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 79472946 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-[[2-(2-aminoethoxy)acetyl]amino]-2,4-difluorobenzoic acid |
| SMILES | NCCOCC(=O)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O4/c12-7-4-8(13)9(3-6(7)11(17)18)15-10(16)5-19-2-1-14/h3-4H,1-2,5,14H2,(H,15,16)(H,17,18) |
| InChIKey | QLXNAVLRZXOZME-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|