C10H11F3N2O2 — CID 79478578
2-(2-aminoethoxy)-N-(3,4,5-trifluorophenyl)acetamide (PubChem CID 79478578) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(3,4,5-trifluorophenyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(3,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 79478578 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(3,4,5-trifluorophenyl)acetamide |
| SMILES | NCCOCC(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H11F3N2O2/c11-7-3-6(4-8(12)10(7)13)15-9(16)5-17-2-1-14/h3-4H,1-2,5,14H2,(H,15,16) |
| InChIKey | NPKGVUCOQLXYIT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|