C14H16F2N2O3 — CID 62675414
2,4-difluoro-5-[(2-piperidin-3-ylacetyl)amino]benzoic acid (PubChem CID 62675414) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2,4-difluoro-5-[(2-piperidin-3-ylacetyl)amino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[(2-piperidin-3-ylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62675414 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2,4-difluoro-5-[(2-piperidin-3-ylacetyl)amino]benzoic acid |
| SMILES | O=C(CC1CCCNC1)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C14H16F2N2O3/c15-10-6-11(16)12(5-9(10)14(20)21)18-13(19)4-8-2-1-3-17-7-8/h5-6,8,17H,1-4,7H2,(H,18,19)(H,20,21) |
| InChIKey | CZXBJLRJGUBSOA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |