C12H12F4N2O — CID 107641614
2-pyrrolidin-3-yl-N-(2,3,5,6-tetrafluorophenyl)acetamide (PubChem CID 107641614) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-N-(2,3,5,6-tetrafluorophenyl)acetamide.
| Compound Name | 2-pyrrolidin-3-yl-N-(2,3,5,6-tetrafluorophenyl)acetamide |
|---|---|
| PubChem CID | 107641614 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-pyrrolidin-3-yl-N-(2,3,5,6-tetrafluorophenyl)acetamide |
| SMILES | O=C(CC1CCNC1)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H12F4N2O/c13-7-4-8(14)11(16)12(10(7)15)18-9(19)3-6-1-2-17-5-6/h4,6,17H,1-3,5H2,(H,18,19) |
| InChIKey | SHXMZRQFGSVUDM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|